C20H16BrFN8O5S — CID 176856673
N-[6-[[5-bromo-2-(4-fluoro-2-methoxy-5-nitroanilino)pyrimidin-4-yl]amino]quinoxalin-5-yl]methanesulfonamide (PubChem CID 176856673) has the molecular formula C20H16BrFN8O5S and a molecular weight of 579.37 g/mol. Its IUPAC name is N-[6-[[5-bromo-2-(4-fluoro-2-methoxy-5-nitroanilino)pyrimidin-4-yl]amino]quinoxalin-5-yl]methanesulfonamide.
| Compound Name | N-[6-[[5-bromo-2-(4-fluoro-2-methoxy-5-nitroanilino)pyrimidin-4-yl]amino]quinoxalin-5-yl]methanesulfonamide |
|---|---|
| PubChem CID | 176856673 |
| Molecular Formula | C20H16BrFN8O5S |
| Molecular Weight | 579.37 g/mol |
| Exact Mass | 578.01 |
| IUPAC Name | N-[6-[[5-bromo-2-(4-fluoro-2-methoxy-5-nitroanilino)pyrimidin-4-yl]amino]quinoxalin-5-yl]methanesulfonamide |
| SMILES | COc1cc(F)c([N+](=O)[O-])cc1Nc1ncc(Br)c(Nc2ccc3nccnc3c2NS(C)(=O)=O)n1 |
| InChI | InChI=1S/C20H16BrFN8O5S/c1-35-16-7-11(22)15(30(31)32)8-14(16)27-20-25-9-10(21)19(28-20)26-13-4-3-12-17(24-6-5-23-12)18(13)29-36(2,33)34/h3-9,29H,1-2H3,(H2,25,26,27,28) |
| InChIKey | JWQILPSGKSLVPV-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 174.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.37 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|