C22H22F4N6O7S — CID 141454103
N-[2-[4-[[4-(4-fluoro-2-methoxy-5-nitroanilino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]-3-methoxyphenoxy]ethyl]methanesulfonamide (PubChem CID 141454103) has the molecular formula C22H22F4N6O7S and a molecular weight of 590.51 g/mol. Its IUPAC name is N-[2-[4-[[4-(4-fluoro-2-methoxy-5-nitroanilino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]-3-methoxyphenoxy]ethyl]methanesulfonamide.
| Compound Name | N-[2-[4-[[4-(4-fluoro-2-methoxy-5-nitroanilino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]-3-methoxyphenoxy]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 141454103 |
| Molecular Formula | C22H22F4N6O7S |
| Molecular Weight | 590.51 g/mol |
| Exact Mass | 590.12 |
| IUPAC Name | N-[2-[4-[[4-(4-fluoro-2-methoxy-5-nitroanilino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]-3-methoxyphenoxy]ethyl]methanesulfonamide |
| SMILES | COc1cc(OCCNS(C)(=O)=O)ccc1Nc1ncc(C(F)(F)F)c(Nc2cc([N+](=O)[O-])c(F)cc2OC)n1 |
| InChI | InChI=1S/C22H22F4N6O7S/c1-37-18-8-12(39-7-6-28-40(3,35)36)4-5-15(18)30-21-27-11-13(22(24,25)26)20(31-21)29-16-10-17(32(33)34)14(23)9-19(16)38-2/h4-5,8-11,28H,6-7H2,1-3H3,(H2,27,29,30,31) |
| InChIKey | HFSCQWKBRGRDIW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 166.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|