C23H23F4N5O7S — CID 141454112
4-N-(4-fluoro-2-methoxy-5-nitrophenyl)-2-N-[2-methoxy-4-(3-methylsulfonylpropoxy)phenyl]-5-(trifluoromethyl)pyrimidine-2,4-diamine (PubChem CID 141454112) has the molecular formula C23H23F4N5O7S and a molecular weight of 589.52 g/mol. Its IUPAC name is 4-N-(4-fluoro-2-methoxy-5-nitrophenyl)-2-N-[2-methoxy-4-(3-methylsulfonylpropoxy)phenyl]-5-(trifluoromethyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-(4-fluoro-2-methoxy-5-nitrophenyl)-2-N-[2-methoxy-4-(3-methylsulfonylpropoxy)phenyl]-5-(trifluoromethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 141454112 |
| Molecular Formula | C23H23F4N5O7S |
| Molecular Weight | 589.52 g/mol |
| Exact Mass | 589.13 |
| IUPAC Name | 4-N-(4-fluoro-2-methoxy-5-nitrophenyl)-2-N-[2-methoxy-4-(3-methylsulfonylpropoxy)phenyl]-5-(trifluoromethyl)pyrimidine-2,4-diamine |
| SMILES | COc1cc(OCCCS(C)(=O)=O)ccc1Nc1ncc(C(F)(F)F)c(Nc2cc([N+](=O)[O-])c(F)cc2OC)n1 |
| InChI | InChI=1S/C23H23F4N5O7S/c1-37-19-9-13(39-7-4-8-40(3,35)36)5-6-16(19)30-22-28-12-14(23(25,26)27)21(31-22)29-17-11-18(32(33)34)15(24)10-20(17)38-2/h5-6,9-12H,4,7-8H2,1-3H3,(H2,28,29,30,31) |
| InChIKey | CVNCQEMMRCNPMC-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 154.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.52 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|