C27H35F3N8O7S — CID 141454082
N-[2-[4-[[4-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]-3-methoxyphenoxy]ethyl]methanesulfonamide (PubChem CID 141454082) has the molecular formula C27H35F3N8O7S and a molecular weight of 672.69 g/mol. Its IUPAC name is N-[2-[4-[[4-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]-3-methoxyphenoxy]ethyl]methanesulfonamide.
| Compound Name | N-[2-[4-[[4-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]-3-methoxyphenoxy]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 141454082 |
| Molecular Formula | C27H35F3N8O7S |
| Molecular Weight | 672.69 g/mol |
| Exact Mass | 672.23 |
| IUPAC Name | N-[2-[4-[[4-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]-3-methoxyphenoxy]ethyl]methanesulfonamide |
| SMILES | COc1cc(OCCNS(C)(=O)=O)ccc1Nc1ncc(C(F)(F)F)c(Nc2cc([N+](=O)[O-])c(N(C)CCN(C)C)cc2OC)n1 |
| InChI | InChI=1S/C27H35F3N8O7S/c1-36(2)10-11-37(3)21-15-24(44-5)20(14-22(21)38(39)40)33-25-18(27(28,29)30)16-31-26(35-25)34-19-8-7-17(13-23(19)43-4)45-12-9-32-46(6,41)42/h7-8,13-16,32H,9-12H2,1-6H3,(H2,31,33,34,35) |
| InChIKey | ZAFOKKKTDWRGDS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 173.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.69 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|