C18H19F5N4O3S — CID 176856769
trans-(1R,2R)-2-[6-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-1,1-dioxo-3H-1,2-benzothiazol-2-yl]-N-(2,2,2-trifluoroethyl)cyclohexan-1-amine (PubChem CID 176856769) has the molecular formula C18H19F5N4O3S and a molecular weight of 466.43 g/mol. Its IUPAC name is trans-(1R,2R)-2-[6-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-1,1-dioxo-3H-1,2-benzothiazol-2-yl]-N-(2,2,2-trifluoroethyl)cyclohexan-1-amine.
| Compound Name | trans-(1R,2R)-2-[6-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-1,1-dioxo-3H-1,2-benzothiazol-2-yl]-N-(2,2,2-trifluoroethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 176856769 |
| Molecular Formula | C18H19F5N4O3S |
| Molecular Weight | 466.43 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | trans-(1R,2R)-2-[6-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-1,1-dioxo-3H-1,2-benzothiazol-2-yl]-N-(2,2,2-trifluoroethyl)cyclohexan-1-amine |
| SMILES | O=S1(=O)c2cc(-c3nnc(C(F)F)o3)ccc2CN1[C@@H]1CCCC[C@H]1NCC(F)(F)F |
| InChI | InChI=1S/C18H19F5N4O3S/c19-15(20)17-26-25-16(30-17)10-5-6-11-8-27(31(28,29)14(11)7-10)13-4-2-1-3-12(13)24-9-18(21,22)23/h5-7,12-13,15,24H,1-4,8-9H2/t12-,13-/m1/s1 |
| InChIKey | PRIUUGPQFFZRJO-CHWSQXEVSA-N |
| XLogP | 3.64 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |