C16H16F4N4O3S — CID 176856854
cis-(1S,6R)-6-[6-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-1,1-dioxo-3H-1,2-benzothiazol-2-yl]-2,2-difluorocyclohexan-1-amine (PubChem CID 176856854) has the molecular formula C16H16F4N4O3S and a molecular weight of 420.39 g/mol. Its IUPAC name is cis-(1S,6R)-6-[6-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-1,1-dioxo-3H-1,2-benzothiazol-2-yl]-2,2-difluorocyclohexan-1-amine.
| Compound Name | cis-(1S,6R)-6-[6-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-1,1-dioxo-3H-1,2-benzothiazol-2-yl]-2,2-difluorocyclohexan-1-amine |
|---|---|
| PubChem CID | 176856854 |
| Molecular Formula | C16H16F4N4O3S |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | cis-(1S,6R)-6-[6-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-1,1-dioxo-3H-1,2-benzothiazol-2-yl]-2,2-difluorocyclohexan-1-amine |
| SMILES | N[C@H]1[C@H](N2Cc3ccc(-c4nnc(C(F)F)o4)cc3S2(=O)=O)CCCC1(F)F |
| InChI | InChI=1S/C16H16F4N4O3S/c17-13(18)15-23-22-14(27-15)8-3-4-9-7-24(28(25,26)11(9)6-8)10-2-1-5-16(19,20)12(10)21/h3-4,6,10,12-13H,1-2,5,7,21H2/t10-,12+/m1/s1 |
| InChIKey | ODGGJSXPEUXUEX-PWSUYJOCSA-N |
| XLogP | 2.69 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |