C23H22F5N5O5 — CID 176860149
6-(3-aminopropanoylamino)-2-[(2R,3S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-5-methyl-5-(trifluoromethyl)oxolan-2-yl]-[1,3]oxazolo[5,4-c]pyridine-4-carboxamide (PubChem CID 176860149) has the molecular formula C23H22F5N5O5 and a molecular weight of 543.45 g/mol. Its IUPAC name is 6-(3-aminopropanoylamino)-2-[(2R,3S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-5-methyl-5-(trifluoromethyl)oxolan-2-yl]-[1,3]oxazolo[5,4-c]pyridine-4-carboxamide.
| Compound Name | 6-(3-aminopropanoylamino)-2-[(2R,3S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-5-methyl-5-(trifluoromethyl)oxolan-2-yl]-[1,3]oxazolo[5,4-c]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 176860149 |
| Molecular Formula | C23H22F5N5O5 |
| Molecular Weight | 543.45 g/mol |
| Exact Mass | 543.15 |
| IUPAC Name | 6-(3-aminopropanoylamino)-2-[(2R,3S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-5-methyl-5-(trifluoromethyl)oxolan-2-yl]-[1,3]oxazolo[5,4-c]pyridine-4-carboxamide |
| SMILES | COc1c([C@@H]2C[C@](C)(C(F)(F)F)O[C@H]2c2nc3cc(NC(=O)CCN)nc(C(N)=O)c3o2)ccc(F)c1F |
| InChI | InChI=1S/C23H22F5N5O5/c1-22(23(26,27)28)8-10(9-3-4-11(24)15(25)17(9)36-2)18(38-22)21-31-12-7-13(32-14(34)5-6-29)33-16(20(30)35)19(12)37-21/h3-4,7,10,18H,5-6,8,29H2,1-2H3,(H2,30,35)(H,32,33,34)/t10-,18+,22+/m0/s1 |
| InChIKey | IOIJIFQJJCMPET-GXEWBMFWSA-N |
| XLogP | 3.46 |
| TPSA | 155.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |