C53H54N7+ — CID 176862410
9-(4-tert-butyl-2-pyridinyl)-2-[4-[3-tert-butyl-5-(3,5,6-trimethylbenzimidazol-3-ium-1-yl)phenyl]-6-(2,4,6-trimethylphenyl)-1,3,5-triazin-2-yl]carbazole (PubChem CID 176862410) has the molecular formula C53H54N7+ and a molecular weight of 789.06 g/mol. Its IUPAC name is 9-(4-tert-butyl-2-pyridinyl)-2-[4-[3-tert-butyl-5-(3,5,6-trimethylbenzimidazol-3-ium-1-yl)phenyl]-6-(2,4,6-trimethylphenyl)-1,3,5-triazin-2-yl]carbazole.
| Compound Name | 9-(4-tert-butyl-2-pyridinyl)-2-[4-[3-tert-butyl-5-(3,5,6-trimethylbenzimidazol-3-ium-1-yl)phenyl]-6-(2,4,6-trimethylphenyl)-1,3,5-triazin-2-yl]carbazole |
|---|---|
| PubChem CID | 176862410 |
| Molecular Formula | C53H54N7+ |
| Molecular Weight | 789.06 g/mol |
| Exact Mass | 788.44 |
| IUPAC Name | 9-(4-tert-butyl-2-pyridinyl)-2-[4-[3-tert-butyl-5-(3,5,6-trimethylbenzimidazol-3-ium-1-yl)phenyl]-6-(2,4,6-trimethylphenyl)-1,3,5-triazin-2-yl]carbazole |
| SMILES | Cc1cc(C)c(-c2nc(-c3cc(-n4c[n+](C)c5cc(C)c(C)cc54)cc(C(C)(C)C)c3)nc(-c3ccc4c5ccccc5n(-c5cc(C(C)(C)C)ccn5)c4c3)n2)c(C)c1 |
| InChI | InChI=1S/C53H54N7/c1-31-21-34(4)48(35(5)22-31)51-56-49(36-17-18-42-41-15-13-14-16-43(41)60(44(42)27-36)47-29-38(19-20-54-47)52(6,7)8)55-50(57-51)37-25-39(53(9,10)11)28-40(26-37)59-30-58(12)45-23-32(2)33(3)24-46(45)59/h13-30H,1-12H3/q+1 |
| InChIKey | QQPTUPKMQHOJSK-UHFFFAOYSA-N |
| XLogP | 12.27 |
| TPSA | 65.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.06 |
| LogP ≤ 5 | 12.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|