C12H13F3N4O2 — CID 176871427
1-[[(Z)-3-amino-2-[6-amino-4-(trifluoromethoxy)-3-pyridinyl]prop-2-enylidene]amino]propan-2-one (PubChem CID 176871427) has the molecular formula C12H13F3N4O2 and a molecular weight of 302.26 g/mol. Its IUPAC name is 1-[[(Z)-3-amino-2-[6-amino-4-(trifluoromethoxy)-3-pyridinyl]prop-2-enylidene]amino]propan-2-one.
| Compound Name | 1-[[(Z)-3-amino-2-[6-amino-4-(trifluoromethoxy)-3-pyridinyl]prop-2-enylidene]amino]propan-2-one |
|---|---|
| PubChem CID | 176871427 |
| Molecular Formula | C12H13F3N4O2 |
| Molecular Weight | 302.26 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 1-[[(Z)-3-amino-2-[6-amino-4-(trifluoromethoxy)-3-pyridinyl]prop-2-enylidene]amino]propan-2-one |
| SMILES | CC(=O)C/N=C/C(=C\N)c1cnc(N)cc1OC(F)(F)F |
| InChI | InChI=1S/C12H13F3N4O2/c1-7(20)4-18-5-8(3-16)9-6-19-11(17)2-10(9)21-12(13,14)15/h2-3,5-6H,4,16H2,1H3,(H2,17,19)/b8-3+,18-5+ |
| InChIKey | CKYZKWRWEYISFG-COENZBDWSA-N |
| XLogP | 1.52 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.26 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|