C49H47N3O — CID 176871903
2-[4-(1-adamantyl)phenyl]-6-[4-[2-(1-adamantyl)-6-phenylpyrimidin-4-yl]phenyl]-1,3-benzoxazole (PubChem CID 176871903) has the molecular formula C49H47N3O and a molecular weight of 693.94 g/mol. Its IUPAC name is 2-[4-(1-adamantyl)phenyl]-6-[4-[2-(1-adamantyl)-6-phenylpyrimidin-4-yl]phenyl]-1,3-benzoxazole.
| Compound Name | 2-[4-(1-adamantyl)phenyl]-6-[4-[2-(1-adamantyl)-6-phenylpyrimidin-4-yl]phenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 176871903 |
| Molecular Formula | C49H47N3O |
| Molecular Weight | 693.94 g/mol |
| Exact Mass | 693.37 |
| IUPAC Name | 2-[4-(1-adamantyl)phenyl]-6-[4-[2-(1-adamantyl)-6-phenylpyrimidin-4-yl]phenyl]-1,3-benzoxazole |
| SMILES | c1ccc(-c2cc(-c3ccc(-c4ccc5nc(-c6ccc(C78CC9CC(CC(C9)C7)C8)cc6)oc5c4)cc3)nc(C34CC5CC(CC(C5)C3)C4)n2)cc1 |
| InChI | InChI=1S/C49H47N3O/c1-2-4-37(5-3-1)43-23-44(52-47(51-43)49-27-33-19-34(28-49)21-35(20-33)29-49)38-8-6-36(7-9-38)40-12-15-42-45(22-40)53-46(50-42)39-10-13-41(14-11-39)48-24-30-16-31(25-48)18-32(17-30)26-48/h1-15,22-23,30-35H,16-21,24-29H2 |
| InChIKey | QTGATVCDYREDGU-UHFFFAOYSA-N |
| XLogP | 12.22 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.94 |
| LogP ≤ 5 | 12.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |