C20H21N3O4 — CID 176872095
[(2R)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl] 4-nitrobenzoate (PubChem CID 176872095) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is [(2R)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl] 4-nitrobenzoate.
| Compound Name | [(2R)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 176872095 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | [(2R)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl] 4-nitrobenzoate |
| SMILES | O=C(OC1C2CCN(CC2)[C@@H]1Cc1cccnc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H21N3O4/c24-20(16-3-5-17(6-4-16)23(25)26)27-19-15-7-10-22(11-8-15)18(19)12-14-2-1-9-21-13-14/h1-6,9,13,15,18-19H,7-8,10-12H2/t18-,19?/m1/s1 |
| InChIKey | HBOQHMDMTFHUMZ-MRTLOADZSA-N |
| XLogP | 2.85 |
| TPSA | 85.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|