C14H17FO — CID 176877276
4-fluoro-5,7-di(propan-2-yl)-1-benzofuran (PubChem CID 176877276) has the molecular formula C14H17FO and a molecular weight of 220.29 g/mol. Its IUPAC name is 4-fluoro-5,7-di(propan-2-yl)-1-benzofuran.
| Compound Name | 4-fluoro-5,7-di(propan-2-yl)-1-benzofuran |
|---|---|
| PubChem CID | 176877276 |
| Molecular Formula | C14H17FO |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 4-fluoro-5,7-di(propan-2-yl)-1-benzofuran |
| SMILES | CC(C)c1cc(C(C)C)c2occc2c1F |
| InChI | InChI=1S/C14H17FO/c1-8(2)11-7-12(9(3)4)14-10(13(11)15)5-6-16-14/h5-9H,1-4H3 |
| InChIKey | KQWCKKHRSODPAB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |