C29H29O5S- — CID 176879737
4-(15,16-dimethyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl)oxy-5-methyl-2-propan-2-ylbenzenesulfonate (PubChem CID 176879737) has the molecular formula C29H29O5S- and a molecular weight of 489.61 g/mol. Its IUPAC name is 4-(15,16-dimethyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl)oxy-5-methyl-2-propan-2-ylbenzenesulfonate.
| Compound Name | 4-(15,16-dimethyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl)oxy-5-methyl-2-propan-2-ylbenzenesulfonate |
|---|---|
| PubChem CID | 176879737 |
| Molecular Formula | C29H29O5S- |
| Molecular Weight | 489.61 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | 4-(15,16-dimethyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl)oxy-5-methyl-2-propan-2-ylbenzenesulfonate |
| SMILES | Cc1cc(S(=O)(=O)[O-])c(C(C)C)cc1OC(=O)C1(C)C2c3ccccc3C(c3ccccc32)C1C |
| InChI | InChI=1S/C29H30O5S/c1-16(2)23-15-24(17(3)14-25(23)35(31,32)33)34-28(30)29(5)18(4)26-19-10-6-8-12-21(19)27(29)22-13-9-7-11-20(22)26/h6-16,18,26-27H,1-5H3,(H,31,32,33)/p-1 |
| InChIKey | AEVDEAYYIGSFMH-UHFFFAOYSA-M |
| XLogP | 5.86 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.61 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|