C16H14I3O6S2- — CID 176636680
5-methyl-2-propan-2-yl-4-(2,3,5-triiodophenyl)sulfonyloxybenzenesulfonate (PubChem CID 176636680) has the molecular formula C16H14I3O6S2- and a molecular weight of 747.13 g/mol. Its IUPAC name is 5-methyl-2-propan-2-yl-4-(2,3,5-triiodophenyl)sulfonyloxybenzenesulfonate.
| Compound Name | 5-methyl-2-propan-2-yl-4-(2,3,5-triiodophenyl)sulfonyloxybenzenesulfonate |
|---|---|
| PubChem CID | 176636680 |
| Molecular Formula | C16H14I3O6S2- |
| Molecular Weight | 747.13 g/mol |
| Exact Mass | 746.74 |
| IUPAC Name | 5-methyl-2-propan-2-yl-4-(2,3,5-triiodophenyl)sulfonyloxybenzenesulfonate |
| SMILES | Cc1cc(S(=O)(=O)[O-])c(C(C)C)cc1OS(=O)(=O)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C16H15I3O6S2/c1-8(2)11-7-13(9(3)4-14(11)26(20,21)22)25-27(23,24)15-6-10(17)5-12(18)16(15)19/h4-8H,1-3H3,(H,20,21,22)/p-1 |
| InChIKey | KDIFOINXLNOKCL-UHFFFAOYSA-M |
| XLogP | 4.60 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.13 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|