C30H59N3O10 — CID 176880703
3-[3-[(3-ethoxy-3-oxopropyl)-(5-hydroxypentyl)amino]propanoyloxy]butyl 3-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propylamino]propanoate (PubChem CID 176880703) has the molecular formula C30H59N3O10 and a molecular weight of 621.81 g/mol. Its IUPAC name is 3-[3-[(3-ethoxy-3-oxopropyl)-(5-hydroxypentyl)amino]propanoyloxy]butyl 3-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propylamino]propanoate.
| Compound Name | 3-[3-[(3-ethoxy-3-oxopropyl)-(5-hydroxypentyl)amino]propanoyloxy]butyl 3-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propylamino]propanoate |
|---|---|
| PubChem CID | 176880703 |
| Molecular Formula | C30H59N3O10 |
| Molecular Weight | 621.81 g/mol |
| Exact Mass | 621.42 |
| IUPAC Name | 3-[3-[(3-ethoxy-3-oxopropyl)-(5-hydroxypentyl)amino]propanoyloxy]butyl 3-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propylamino]propanoate |
| SMILES | CCOC(=O)CCN(CCCCCO)CCC(=O)OC(C)CCOC(=O)CCNCCCOCCOCCOCCCN |
| InChI | InChI=1S/C30H59N3O10/c1-3-41-29(36)10-17-33(16-5-4-6-19-34)18-11-30(37)43-27(2)12-22-42-28(35)9-15-32-14-8-21-39-24-26-40-25-23-38-20-7-13-31/h27,32,34H,3-26,31H2,1-2H3 |
| InChIKey | GVCGYQDETAGBFV-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 168.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.81 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|