C25H25N3O5 — CID 176882655
N-[(3S)-5-methyl-7-[2-(oxetan-3-yl)ethynyl]-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-N'-[(1R)-1-phenylethyl]oxamide (PubChem CID 176882655) has the molecular formula C25H25N3O5 and a molecular weight of 447.49 g/mol. Its IUPAC name is N-[(3S)-5-methyl-7-[2-(oxetan-3-yl)ethynyl]-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-N'-[(1R)-1-phenylethyl]oxamide.
| Compound Name | N-[(3S)-5-methyl-7-[2-(oxetan-3-yl)ethynyl]-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-N'-[(1R)-1-phenylethyl]oxamide |
|---|---|
| PubChem CID | 176882655 |
| Molecular Formula | C25H25N3O5 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | N-[(3S)-5-methyl-7-[2-(oxetan-3-yl)ethynyl]-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-N'-[(1R)-1-phenylethyl]oxamide |
| SMILES | C[C@@H](NC(=O)C(=O)N[C@H]1COc2ccc(C#CC3COC3)cc2N(C)C1=O)c1ccccc1 |
| InChI | InChI=1S/C25H25N3O5/c1-16(19-6-4-3-5-7-19)26-23(29)24(30)27-20-15-33-22-11-10-17(8-9-18-13-32-14-18)12-21(22)28(2)25(20)31/h3-7,10-12,16,18,20H,13-15H2,1-2H3,(H,26,29)(H,27,30)/t16-,20+/m1/s1 |
| InChIKey | PKKSPFPEJZJEIS-UZLBHIALSA-N |
| XLogP | 1.40 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|