C28H32N4O4 — CID 176882674
N-[(3S)-5-methyl-7-[2-(1-methylpiperidin-4-yl)ethynyl]-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-N'-[(1R)-1-phenylethyl]oxamide (PubChem CID 176882674) has the molecular formula C28H32N4O4 and a molecular weight of 488.59 g/mol. Its IUPAC name is N-[(3S)-5-methyl-7-[2-(1-methylpiperidin-4-yl)ethynyl]-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-N'-[(1R)-1-phenylethyl]oxamide.
| Compound Name | N-[(3S)-5-methyl-7-[2-(1-methylpiperidin-4-yl)ethynyl]-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-N'-[(1R)-1-phenylethyl]oxamide |
|---|---|
| PubChem CID | 176882674 |
| Molecular Formula | C28H32N4O4 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | N-[(3S)-5-methyl-7-[2-(1-methylpiperidin-4-yl)ethynyl]-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-N'-[(1R)-1-phenylethyl]oxamide |
| SMILES | C[C@@H](NC(=O)C(=O)N[C@H]1COc2ccc(C#CC3CCN(C)CC3)cc2N(C)C1=O)c1ccccc1 |
| InChI | InChI=1S/C28H32N4O4/c1-19(22-7-5-4-6-8-22)29-26(33)27(34)30-23-18-36-25-12-11-21(17-24(25)32(3)28(23)35)10-9-20-13-15-31(2)16-14-20/h4-8,11-12,17,19-20,23H,13-16,18H2,1-3H3,(H,29,33)(H,30,34)/t19-,23+/m1/s1 |
| InChIKey | YTOJTQKSZMMEAI-XXBNENTESA-N |
| XLogP | 2.10 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|