C20H30N4O5S2 — CID 176883996
(2'R,4S)-2-ethyl-2'-methyl-1'-[[1-(2-methylsulfonylethyl)triazol-4-yl]methyl]spiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine] 1,1-dioxide (PubChem CID 176883996) has the molecular formula C20H30N4O5S2 and a molecular weight of 470.62 g/mol. Its IUPAC name is (2'R,4S)-2-ethyl-2'-methyl-1'-[[1-(2-methylsulfonylethyl)triazol-4-yl]methyl]spiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine] 1,1-dioxide.
| Compound Name | (2'R,4S)-2-ethyl-2'-methyl-1'-[[1-(2-methylsulfonylethyl)triazol-4-yl]methyl]spiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine] 1,1-dioxide |
|---|---|
| PubChem CID | 176883996 |
| Molecular Formula | C20H30N4O5S2 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | (2'R,4S)-2-ethyl-2'-methyl-1'-[[1-(2-methylsulfonylethyl)triazol-4-yl]methyl]spiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine] 1,1-dioxide |
| SMILES | CCC1=CC2=C(CCO[C@]23CCN(Cc2cn(CCS(C)(=O)=O)nn2)[C@H](C)C3)S1(=O)=O |
| InChI | InChI=1S/C20H30N4O5S2/c1-4-17-11-18-19(31(17,27)28)5-9-29-20(18)6-7-23(15(2)12-20)13-16-14-24(22-21-16)8-10-30(3,25)26/h11,14-15H,4-10,12-13H2,1-3H3/t15-,20+/m1/s1 |
| InChIKey | OFMHJHDANWBRRB-QRWLVFNGSA-N |
| XLogP | 1.44 |
| TPSA | 111.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |