C19H24N4O4 — CID 176885210
tert-butyl N-[[2-[3-(hydrazinecarbonyl)-5-methoxyphenyl]-4-pyridinyl]methyl]carbamate (PubChem CID 176885210) has the molecular formula C19H24N4O4 and a molecular weight of 372.43 g/mol. Its IUPAC name is tert-butyl N-[[2-[3-(hydrazinecarbonyl)-5-methoxyphenyl]-4-pyridinyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-[3-(hydrazinecarbonyl)-5-methoxyphenyl]-4-pyridinyl]methyl]carbamate |
|---|---|
| PubChem CID | 176885210 |
| Molecular Formula | C19H24N4O4 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | tert-butyl N-[[2-[3-(hydrazinecarbonyl)-5-methoxyphenyl]-4-pyridinyl]methyl]carbamate |
| SMILES | COc1cc(C(=O)NN)cc(-c2cc(CNC(=O)OC(C)(C)C)ccn2)c1 |
| InChI | InChI=1S/C19H24N4O4/c1-19(2,3)27-18(25)22-11-12-5-6-21-16(7-12)13-8-14(17(24)23-20)10-15(9-13)26-4/h5-10H,11,20H2,1-4H3,(H,22,25)(H,23,24) |
| InChIKey | GDZKODJQIKFCPR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|