C25H26N4O7S — CID 176885220
N-[[2-[3-[[(2,6-dimethoxyphenyl)sulfonylamino]carbamoyl]-5-methoxyphenyl]-4-pyridinyl]methyl]prop-2-enamide (PubChem CID 176885220) has the molecular formula C25H26N4O7S and a molecular weight of 526.57 g/mol. Its IUPAC name is N-[[2-[3-[[(2,6-dimethoxyphenyl)sulfonylamino]carbamoyl]-5-methoxyphenyl]-4-pyridinyl]methyl]prop-2-enamide.
| Compound Name | N-[[2-[3-[[(2,6-dimethoxyphenyl)sulfonylamino]carbamoyl]-5-methoxyphenyl]-4-pyridinyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 176885220 |
| Molecular Formula | C25H26N4O7S |
| Molecular Weight | 526.57 g/mol |
| Exact Mass | 526.15 |
| IUPAC Name | N-[[2-[3-[[(2,6-dimethoxyphenyl)sulfonylamino]carbamoyl]-5-methoxyphenyl]-4-pyridinyl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCc1ccnc(-c2cc(OC)cc(C(=O)NNS(=O)(=O)c3c(OC)cccc3OC)c2)c1 |
| InChI | InChI=1S/C25H26N4O7S/c1-5-23(30)27-15-16-9-10-26-20(11-16)17-12-18(14-19(13-17)34-2)25(31)28-29-37(32,33)24-21(35-3)7-6-8-22(24)36-4/h5-14,29H,1,15H2,2-4H3,(H,27,30)(H,28,31) |
| InChIKey | RXEJOHYIBQOKGX-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 144.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.57 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|