C25H24N4O6S — CID 169079202
N-[[2-[3-[[(2,6-dimethoxyphenyl)sulfonylamino]carbamoyl]-5-methylphenyl]-4-pyridinyl]methyl]prop-2-ynamide (PubChem CID 169079202) has the molecular formula C25H24N4O6S and a molecular weight of 508.56 g/mol. Its IUPAC name is N-[[2-[3-[[(2,6-dimethoxyphenyl)sulfonylamino]carbamoyl]-5-methylphenyl]-4-pyridinyl]methyl]prop-2-ynamide.
| Compound Name | N-[[2-[3-[[(2,6-dimethoxyphenyl)sulfonylamino]carbamoyl]-5-methylphenyl]-4-pyridinyl]methyl]prop-2-ynamide |
|---|---|
| PubChem CID | 169079202 |
| Molecular Formula | C25H24N4O6S |
| Molecular Weight | 508.56 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | N-[[2-[3-[[(2,6-dimethoxyphenyl)sulfonylamino]carbamoyl]-5-methylphenyl]-4-pyridinyl]methyl]prop-2-ynamide |
| SMILES | C#CC(=O)NCc1ccnc(-c2cc(C)cc(C(=O)NNS(=O)(=O)c3c(OC)cccc3OC)c2)c1 |
| InChI | InChI=1S/C25H24N4O6S/c1-5-23(30)27-15-17-9-10-26-20(13-17)18-11-16(2)12-19(14-18)25(31)28-29-36(32,33)24-21(34-3)7-6-8-22(24)35-4/h1,6-14,29H,15H2,2-4H3,(H,27,30)(H,28,31) |
| InChIKey | WSIQUCMLVGNZCR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 135.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.56 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|