C16H10ClF2NO5 — CID 176888993
2-[2-(4-chloro-2-fluorophenyl)acetyl]-5-fluoro-4-methyl-3-nitrobenzoic acid (PubChem CID 176888993) has the molecular formula C16H10ClF2NO5 and a molecular weight of 369.71 g/mol. Its IUPAC name is 2-[2-(4-chloro-2-fluorophenyl)acetyl]-5-fluoro-4-methyl-3-nitrobenzoic acid.
| Compound Name | 2-[2-(4-chloro-2-fluorophenyl)acetyl]-5-fluoro-4-methyl-3-nitrobenzoic acid |
|---|---|
| PubChem CID | 176888993 |
| Molecular Formula | C16H10ClF2NO5 |
| Molecular Weight | 369.71 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | 2-[2-(4-chloro-2-fluorophenyl)acetyl]-5-fluoro-4-methyl-3-nitrobenzoic acid |
| SMILES | Cc1c(F)cc(C(=O)O)c(C(=O)Cc2ccc(Cl)cc2F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H10ClF2NO5/c1-7-11(18)6-10(16(22)23)14(15(7)20(24)25)13(21)4-8-2-3-9(17)5-12(8)19/h2-3,5-6H,4H2,1H3,(H,22,23) |
| InChIKey | MPPGQQJMKNEZJS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.71 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|