C22H25NOS2 — CID 176896715
4-(4-octoxyphenyl)-3,9-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraene (PubChem CID 176896715) has the molecular formula C22H25NOS2 and a molecular weight of 383.58 g/mol. Its IUPAC name is 4-(4-octoxyphenyl)-3,9-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraene.
| Compound Name | 4-(4-octoxyphenyl)-3,9-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraene |
|---|---|
| PubChem CID | 176896715 |
| Molecular Formula | C22H25NOS2 |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 4-(4-octoxyphenyl)-3,9-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraene |
| SMILES | CCCCCCCCOc1ccc(-c2cc3[nH]c4sccc4c3s2)cc1 |
| InChI | InChI=1S/C22H25NOS2/c1-2-3-4-5-6-7-13-24-17-10-8-16(9-11-17)20-15-19-21(26-20)18-12-14-25-22(18)23-19/h8-12,14-15,23H,2-7,13H2,1H3 |
| InChIKey | KNFXMPRHAODPHC-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|