C18H34O — CID 176899565
4-(2,2-dimethylhept-3-en-4-yloxy)-2,2-dimethylhept-3-ene (PubChem CID 176899565) has the molecular formula C18H34O and a molecular weight of 266.47 g/mol. Its IUPAC name is 4-(2,2-dimethylhept-3-en-4-yloxy)-2,2-dimethylhept-3-ene.
| Compound Name | 4-(2,2-dimethylhept-3-en-4-yloxy)-2,2-dimethylhept-3-ene |
|---|---|
| PubChem CID | 176899565 |
| Molecular Formula | C18H34O |
| Molecular Weight | 266.47 g/mol |
| Exact Mass | 266.26 |
| IUPAC Name | 4-(2,2-dimethylhept-3-en-4-yloxy)-2,2-dimethylhept-3-ene |
| SMILES | CCCC(=CC(C)(C)C)OC(=CC(C)(C)C)CCC |
| InChI | InChI=1S/C18H34O/c1-9-11-15(13-17(3,4)5)19-16(12-10-2)14-18(6,7)8/h13-14H,9-12H2,1-8H3 |
| InChIKey | IHXSENHBUNGVBB-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.47 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|