About (E)-4-[(E)-5,5-dimethylhept-3-en-4-yl]oxy-5,5-dimethylhept-3-ene
(E)-4-[(E)-5,5-dimethylhept-3-en-4-yl]oxy-5,5-dimethylhept-3-ene (PubChem CID 88509905) has the molecular formula C18H34O
and a molecular weight of 266.47 g/mol. Its IUPAC name is (E)-4-[(E)-5,5-dimethylhept-3-en-4-yl]oxy-5,5-dimethylhept-3-ene.
Molecular Properties
| Compound Name | (E)-4-[(E)-5,5-dimethylhept-3-en-4-yl]oxy-5,5-dimethylhept-3-ene |
| PubChem CID | 88509905 |
| Molecular Formula | C18H34O |
| Molecular Weight | 266.47 g/mol |
| Exact Mass | 266.26 |
| IUPAC Name | (E)-4-[(E)-5,5-dimethylhept-3-en-4-yl]oxy-5,5-dimethylhept-3-ene |
| SMILES | CC/C=C(/O/C(=C/CC)C(C)(C)CC)C(C)(C)CC |
| InChI | InChI=1S/C18H34O/c1-9-13-15(17(5,6)11-3)19-16(14-10-2)18(7,8)12-4/h13-14H,9-12H2,1-8H3/b15-13+,16-14+ |
| InChIKey | YZNKXUTZDGKEDV-WXUKJITCSA-N |
| XLogP | 6.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 266.47 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-[(E)-5,5-dimethylhept-3-en-4-yl]oxy-5,5-dimethylhept-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-[(E)-5,5-dimethylhept-3-en-4-yl]oxy-5,5-dimethylhept-3-ene?
The IUPAC name of (E)-4-[(E)-5,5-dimethylhept-3-en-4-yl]oxy-5,5-dimethylhept-3-ene (CID 88509905) is (E)-4-[(E)-5,5-dimethylhept-3-en-4-yl]oxy-5,5-dimethylhept-3-ene.
What is the SMILES notation for (E)-4-[(E)-5,5-dimethylhept-3-en-4-yl]oxy-5,5-dimethylhept-3-ene?
The canonical SMILES for (E)-4-[(E)-5,5-dimethylhept-3-en-4-yl]oxy-5,5-dimethylhept-3-ene is CC/C=C(/O/C(=C/CC)C(C)(C)CC)C(C)(C)CC.
What is the InChIKey of (E)-4-[(E)-5,5-dimethylhept-3-en-4-yl]oxy-5,5-dimethylhept-3-ene?
The InChIKey is YZNKXUTZDGKEDV-WXUKJITCSA-N. The full InChI is InChI=1S/C18H34O/c1-9-13-15(17(5,6)11-3)19-16(14-10-2)18(7,8)12-4/h13-14H,9-12H2,1-8H3/b15-13+,16-14+.
What are the key properties of (E)-4-[(E)-5,5-dimethylhept-3-en-4-yl]oxy-5,5-dimethylhept-3-ene?
(E)-4-[(E)-5,5-dimethylhept-3-en-4-yl]oxy-5,5-dimethylhept-3-ene has a molecular weight of 266.47 g/mol, XLogP of 6.46, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-[(E)-5,5-dimethylhept-3-en-4-yl]oxy-5,5-dimethylhept-3-ene is sourced from PubChem (CID 88509905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).