C14H24O — CID 135043198
(5E)-6-ethoxy-4,4-dimethyldeca-1,5,9-triene (PubChem CID 135043198) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is (5E)-6-ethoxy-4,4-dimethyldeca-1,5,9-triene.
| Compound Name | (5E)-6-ethoxy-4,4-dimethyldeca-1,5,9-triene |
|---|---|
| PubChem CID | 135043198 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | (5E)-6-ethoxy-4,4-dimethyldeca-1,5,9-triene |
| SMILES | C=CCC/C(=C\C(C)(C)CC=C)OCC |
| InChI | InChI=1S/C14H24O/c1-6-9-10-13(15-8-3)12-14(4,5)11-7-2/h6-7,12H,1-2,8-11H2,3-5H3/b13-12+ |
| InChIKey | HANJHYZLBULLEX-OUKQBFOZSA-N |
| XLogP | 4.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|