C12H22O2 — CID 10442729
(1E,6E)-1,7-dimethoxy-4,4-dimethylocta-1,6-diene (PubChem CID 10442729) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is (1E,6E)-1,7-dimethoxy-4,4-dimethylocta-1,6-diene.
| Compound Name | (1E,6E)-1,7-dimethoxy-4,4-dimethylocta-1,6-diene |
|---|---|
| PubChem CID | 10442729 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (1E,6E)-1,7-dimethoxy-4,4-dimethylocta-1,6-diene |
| SMILES | CO/C=C/CC(C)(C)C/C=C(\C)OC |
| InChI | InChI=1S/C12H22O2/c1-11(14-5)7-9-12(2,3)8-6-10-13-4/h6-7,10H,8-9H2,1-5H3/b10-6+,11-7+ |
| InChIKey | PQJSQPAAVMMUOM-JMQWPVDRSA-N |
| XLogP | 3.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|