C12H20O — CID 135028315
(1E,5Z)-1-ethoxy-3,3-dimethylcycloocta-1,5-diene (PubChem CID 135028315) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is (1E,5Z)-1-ethoxy-3,3-dimethylcycloocta-1,5-diene.
| Compound Name | (1E,5Z)-1-ethoxy-3,3-dimethylcycloocta-1,5-diene |
|---|---|
| PubChem CID | 135028315 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | (1E,5Z)-1-ethoxy-3,3-dimethylcycloocta-1,5-diene |
| SMILES | CCO/C1=C/C(C)(C)C/C=C\CC1 |
| InChI | InChI=1S/C12H20O/c1-4-13-11-8-6-5-7-9-12(2,3)10-11/h5,7,10H,4,6,8-9H2,1-3H3/b7-5-,11-10+ |
| InChIKey | ZXQNBFLXJSPXIT-OLCNXZRBSA-N |
| XLogP | 3.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|