C10H16O — CID 123264118
2,4-dimethyl-4-propan-2-ylpyran (PubChem CID 123264118) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is 2,4-dimethyl-4-propan-2-ylpyran.
| Compound Name | 2,4-dimethyl-4-propan-2-ylpyran |
|---|---|
| PubChem CID | 123264118 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | 2,4-dimethyl-4-propan-2-ylpyran |
| SMILES | CC1=CC(C)(C(C)C)C=CO1 |
| InChI | InChI=1S/C10H16O/c1-8(2)10(4)5-6-11-9(3)7-10/h5-8H,1-4H3 |
| InChIKey | KYJKIXOTKBWFDW-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |