C10H12F2N2O4S — CID 176900964
ethyl 2-[4-(difluoromethyl)-6-methylpyrimidin-2-yl]sulfonylacetate (PubChem CID 176900964) has the molecular formula C10H12F2N2O4S and a molecular weight of 294.28 g/mol. Its IUPAC name is ethyl 2-[4-(difluoromethyl)-6-methylpyrimidin-2-yl]sulfonylacetate.
| Compound Name | ethyl 2-[4-(difluoromethyl)-6-methylpyrimidin-2-yl]sulfonylacetate |
|---|---|
| PubChem CID | 176900964 |
| Molecular Formula | C10H12F2N2O4S |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | ethyl 2-[4-(difluoromethyl)-6-methylpyrimidin-2-yl]sulfonylacetate |
| SMILES | CCOC(=O)CS(=O)(=O)c1nc(C)cc(C(F)F)n1 |
| InChI | InChI=1S/C10H12F2N2O4S/c1-3-18-8(15)5-19(16,17)10-13-6(2)4-7(14-10)9(11)12/h4,9H,3,5H2,1-2H3 |
| InChIKey | RMGWVKDCHZCHPC-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 86.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |