C37H34N6O4 — CID 176904793
N-[1-(4-methoxyphenyl)-9-methylpyrido[3,4-b]indol-3-yl]-4-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]benzamide (PubChem CID 176904793) has the molecular formula C37H34N6O4 and a molecular weight of 626.72 g/mol. Its IUPAC name is N-[1-(4-methoxyphenyl)-9-methylpyrido[3,4-b]indol-3-yl]-4-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]benzamide.
| Compound Name | N-[1-(4-methoxyphenyl)-9-methylpyrido[3,4-b]indol-3-yl]-4-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 176904793 |
| Molecular Formula | C37H34N6O4 |
| Molecular Weight | 626.72 g/mol |
| Exact Mass | 626.26 |
| IUPAC Name | N-[1-(4-methoxyphenyl)-9-methylpyrido[3,4-b]indol-3-yl]-4-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]benzamide |
| SMILES | COc1ccc(-c2nc(NC(=O)c3ccc(CN4CCN(c5ccc([N+](=O)[O-])cc5)CC4)cc3)cc3c4ccccc4n(C)c23)cc1 |
| InChI | InChI=1S/C37H34N6O4/c1-40-33-6-4-3-5-31(33)32-23-34(38-35(36(32)40)26-11-17-30(47-2)18-12-26)39-37(44)27-9-7-25(8-10-27)24-41-19-21-42(22-20-41)28-13-15-29(16-14-28)43(45)46/h3-18,23H,19-22,24H2,1-2H3,(H,38,39,44) |
| InChIKey | MSAGQJRHRCCGOV-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 105.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.72 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|