C30H56N4O7 — CID 176905115
tert-butyl N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-N-[4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl-pent-4-enylamino]-4-oxobutyl]carbamate (PubChem CID 176905115) has the molecular formula C30H56N4O7 and a molecular weight of 584.80 g/mol. Its IUPAC name is tert-butyl N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-N-[4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl-pent-4-enylamino]-4-oxobutyl]carbamate.
| Compound Name | tert-butyl N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-N-[4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl-pent-4-enylamino]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 176905115 |
| Molecular Formula | C30H56N4O7 |
| Molecular Weight | 584.80 g/mol |
| Exact Mass | 584.41 |
| IUPAC Name | tert-butyl N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-N-[4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl-pent-4-enylamino]-4-oxobutyl]carbamate |
| SMILES | C=CCCCN(CCCNC(=O)OC(C)(C)C)C(=O)CCCN(CCCNC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H56N4O7/c1-11-12-13-20-33(22-15-18-31-25(36)39-28(2,3)4)24(35)17-14-21-34(27(38)41-30(8,9)10)23-16-19-32-26(37)40-29(5,6)7/h11H,1,12-23H2,2-10H3,(H,31,36)(H,32,37) |
| InChIKey | LEVSLYVHTDOVGV-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 126.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.80 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|