C28H33N3O2 — CID 176905240
2-methoxy-5-(4-methylpiperazin-1-yl)-N-[1-(1,2,3,4-tetrahydroacenaphthylen-5-yl)cyclopropyl]benzamide (PubChem CID 176905240) has the molecular formula C28H33N3O2 and a molecular weight of 443.59 g/mol. Its IUPAC name is 2-methoxy-5-(4-methylpiperazin-1-yl)-N-[1-(1,2,3,4-tetrahydroacenaphthylen-5-yl)cyclopropyl]benzamide.
| Compound Name | 2-methoxy-5-(4-methylpiperazin-1-yl)-N-[1-(1,2,3,4-tetrahydroacenaphthylen-5-yl)cyclopropyl]benzamide |
|---|---|
| PubChem CID | 176905240 |
| Molecular Formula | C28H33N3O2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | 2-methoxy-5-(4-methylpiperazin-1-yl)-N-[1-(1,2,3,4-tetrahydroacenaphthylen-5-yl)cyclopropyl]benzamide |
| SMILES | COc1ccc(N2CCN(C)CC2)cc1C(=O)NC1(C2=c3cccc4c3=C(CC2)CC4)CC1 |
| InChI | InChI=1S/C28H33N3O2/c1-30-14-16-31(17-15-30)21-9-11-25(33-2)23(18-21)27(32)29-28(12-13-28)24-10-8-20-7-6-19-4-3-5-22(24)26(19)20/h3-5,9,11,18H,6-8,10,12-17H2,1-2H3,(H,29,32) |
| InChIKey | ZICMSZHKJLTPNV-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|