C25H24FN7O — CID 176905754
[6-(2-amino-[1,2,4]triazolo[1,5-a]pyridin-7-yl)-2,3-dihydropyrrolo[3,2-b]pyridin-1-yl]-[2-(3-fluorophenyl)-4-methylpyrrolidin-1-yl]methanone (PubChem CID 176905754) has the molecular formula C25H24FN7O and a molecular weight of 457.51 g/mol. Its IUPAC name is [6-(2-amino-[1,2,4]triazolo[1,5-a]pyridin-7-yl)-2,3-dihydropyrrolo[3,2-b]pyridin-1-yl]-[2-(3-fluorophenyl)-4-methylpyrrolidin-1-yl]methanone.
| Compound Name | [6-(2-amino-[1,2,4]triazolo[1,5-a]pyridin-7-yl)-2,3-dihydropyrrolo[3,2-b]pyridin-1-yl]-[2-(3-fluorophenyl)-4-methylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 176905754 |
| Molecular Formula | C25H24FN7O |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | [6-(2-amino-[1,2,4]triazolo[1,5-a]pyridin-7-yl)-2,3-dihydropyrrolo[3,2-b]pyridin-1-yl]-[2-(3-fluorophenyl)-4-methylpyrrolidin-1-yl]methanone |
| SMILES | CC1CC(c2cccc(F)c2)N(C(=O)N2CCc3ncc(-c4ccn5nc(N)nc5c4)cc32)C1 |
| InChI | InChI=1S/C25H24FN7O/c1-15-9-21(17-3-2-4-19(26)10-17)32(14-15)25(34)31-7-6-20-22(31)11-18(13-28-20)16-5-8-33-23(12-16)29-24(27)30-33/h2-5,8,10-13,15,21H,6-7,9,14H2,1H3,(H2,27,30) |
| InChIKey | WATRXAJQLWJIFT-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 92.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |