C31H35NO7 — CID 176907793
(2R)-2-amino-2-[2-[4-[[3-methoxy-5-[2-(4-methoxyphenyl)ethenyl]phenoxy]methyl]phenoxy]acetyl]-4-methylpentanoic acid (PubChem CID 176907793) has the molecular formula C31H35NO7 and a molecular weight of 533.62 g/mol. Its IUPAC name is (2R)-2-amino-2-[2-[4-[[3-methoxy-5-[2-(4-methoxyphenyl)ethenyl]phenoxy]methyl]phenoxy]acetyl]-4-methylpentanoic acid.
| Compound Name | (2R)-2-amino-2-[2-[4-[[3-methoxy-5-[2-(4-methoxyphenyl)ethenyl]phenoxy]methyl]phenoxy]acetyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 176907793 |
| Molecular Formula | C31H35NO7 |
| Molecular Weight | 533.62 g/mol |
| Exact Mass | 533.24 |
| IUPAC Name | (2R)-2-amino-2-[2-[4-[[3-methoxy-5-[2-(4-methoxyphenyl)ethenyl]phenoxy]methyl]phenoxy]acetyl]-4-methylpentanoic acid |
| SMILES | COc1ccc(C=Cc2cc(OC)cc(OCc3ccc(OCC(=O)[C@](N)(CC(C)C)C(=O)O)cc3)c2)cc1 |
| InChI | InChI=1S/C31H35NO7/c1-21(2)18-31(32,30(34)35)29(33)20-39-26-13-9-23(10-14-26)19-38-28-16-24(15-27(17-28)37-4)6-5-22-7-11-25(36-3)12-8-22/h5-17,21H,18-20,32H2,1-4H3,(H,34,35)/t31-/m1/s1 |
| InChIKey | WGHMZLHDPHIOEU-WJOKGBTCSA-N |
| XLogP | 5.23 |
| TPSA | 117.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.62 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|