C32H37NO8 — CID 176907768
(2S)-2-[[2-[4-[[3-methoxy-5-[(E)-2-(4-methoxyphenyl)ethenyl]phenoxy]methyl]phenyl]peroxy-2-methylpropanoyl]amino]-3-methylbutanoic acid (PubChem CID 176907768) has the molecular formula C32H37NO8 and a molecular weight of 563.65 g/mol. Its IUPAC name is (2S)-2-[[2-[4-[[3-methoxy-5-[(E)-2-(4-methoxyphenyl)ethenyl]phenoxy]methyl]phenyl]peroxy-2-methylpropanoyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[2-[4-[[3-methoxy-5-[(E)-2-(4-methoxyphenyl)ethenyl]phenoxy]methyl]phenyl]peroxy-2-methylpropanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 176907768 |
| Molecular Formula | C32H37NO8 |
| Molecular Weight | 563.65 g/mol |
| Exact Mass | 563.25 |
| IUPAC Name | (2S)-2-[[2-[4-[[3-methoxy-5-[(E)-2-(4-methoxyphenyl)ethenyl]phenoxy]methyl]phenyl]peroxy-2-methylpropanoyl]amino]-3-methylbutanoic acid |
| SMILES | COc1ccc(/C=C/c2cc(OC)cc(OCc3ccc(OOC(C)(C)C(=O)N[C@H](C(=O)O)C(C)C)cc3)c2)cc1 |
| InChI | InChI=1S/C32H37NO8/c1-21(2)29(30(34)35)33-31(36)32(3,4)41-40-26-15-11-23(12-16-26)20-39-28-18-24(17-27(19-28)38-6)8-7-22-9-13-25(37-5)14-10-22/h7-19,21,29H,20H2,1-6H3,(H,33,36)(H,34,35)/b8-7+/t29-/m0/s1 |
| InChIKey | JCXSGRZXEDVYBD-CJXXQJBOSA-N |
| XLogP | 5.77 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.65 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|