C11H14N2OS2 — CID 176908918
N-[2,4-bis(sulfanyl)phenyl]pyrrolidine-1-carboxamide (PubChem CID 176908918) has the molecular formula C11H14N2OS2 and a molecular weight of 254.38 g/mol. Its IUPAC name is N-[2,4-bis(sulfanyl)phenyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[2,4-bis(sulfanyl)phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 176908918 |
| Molecular Formula | C11H14N2OS2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | N-[2,4-bis(sulfanyl)phenyl]pyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1ccc(S)cc1S)N1CCCC1 |
| InChI | InChI=1S/C11H14N2OS2/c14-11(13-5-1-2-6-13)12-9-4-3-8(15)7-10(9)16/h3-4,7,15-16H,1-2,5-6H2,(H,12,14) |
| InChIKey | KPINACYHLRRQHZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|