C20H30N4O — CID 176910502
(6R)-6-[4-(2-cyclobutyloxy-3-pyridinyl)piperazin-1-yl]-2-azaspiro[3.4]octane (PubChem CID 176910502) has the molecular formula C20H30N4O and a molecular weight of 342.49 g/mol. Its IUPAC name is (6R)-6-[4-(2-cyclobutyloxy-3-pyridinyl)piperazin-1-yl]-2-azaspiro[3.4]octane.
| Compound Name | (6R)-6-[4-(2-cyclobutyloxy-3-pyridinyl)piperazin-1-yl]-2-azaspiro[3.4]octane |
|---|---|
| PubChem CID | 176910502 |
| Molecular Formula | C20H30N4O |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | (6R)-6-[4-(2-cyclobutyloxy-3-pyridinyl)piperazin-1-yl]-2-azaspiro[3.4]octane |
| SMILES | c1cnc(OC2CCC2)c(N2CCN([C@@H]3CCC4(CNC4)C3)CC2)c1 |
| InChI | InChI=1S/C20H30N4O/c1-3-17(4-1)25-19-18(5-2-8-22-19)24-11-9-23(10-12-24)16-6-7-20(13-16)14-21-15-20/h2,5,8,16-17,21H,1,3-4,6-7,9-15H2/t16-/m1/s1 |
| InChIKey | QGSVVELAVKCQAN-MRXNPFEDSA-N |
| XLogP | 2.28 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |