C20H26N6 — CID 171849644
6-[4-(3-pyrazin-2-yl-2-pyridinyl)piperazin-1-yl]-2-azaspiro[3.4]octane (PubChem CID 171849644) has the molecular formula C20H26N6 and a molecular weight of 350.47 g/mol. Its IUPAC name is 6-[4-(3-pyrazin-2-yl-2-pyridinyl)piperazin-1-yl]-2-azaspiro[3.4]octane.
| Compound Name | 6-[4-(3-pyrazin-2-yl-2-pyridinyl)piperazin-1-yl]-2-azaspiro[3.4]octane |
|---|---|
| PubChem CID | 171849644 |
| Molecular Formula | C20H26N6 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | 6-[4-(3-pyrazin-2-yl-2-pyridinyl)piperazin-1-yl]-2-azaspiro[3.4]octane |
| SMILES | c1cnc(N2CCN(C3CCC4(CNC4)C3)CC2)c(-c2cnccn2)c1 |
| InChI | InChI=1S/C20H26N6/c1-2-17(18-13-21-6-7-23-18)19(24-5-1)26-10-8-25(9-11-26)16-3-4-20(12-16)14-22-15-20/h1-2,5-7,13,16,22H,3-4,8-12,14-15H2 |
| InChIKey | PWHGEUQNRXAQBA-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |