C34H36ClN5O12P2 — CID 176910541
[2-aminoethoxy(hydroxy)phosphoryl] [(8S)-8-(chloromethyl)-2-(2,3-dihydroindole-1-carbonyl)-6-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indol-4-yl] hydrogen phosphate (PubChem CID 176910541) has the molecular formula C34H36ClN5O12P2 and a molecular weight of 804.09 g/mol. Its IUPAC name is [2-aminoethoxy(hydroxy)phosphoryl] [(8S)-8-(chloromethyl)-2-(2,3-dihydroindole-1-carbonyl)-6-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indol-4-yl] hydrogen phosphate.
| Compound Name | [2-aminoethoxy(hydroxy)phosphoryl] [(8S)-8-(chloromethyl)-2-(2,3-dihydroindole-1-carbonyl)-6-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indol-4-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 176910541 |
| Molecular Formula | C34H36ClN5O12P2 |
| Molecular Weight | 804.09 g/mol |
| Exact Mass | 803.15 |
| IUPAC Name | [2-aminoethoxy(hydroxy)phosphoryl] [(8S)-8-(chloromethyl)-2-(2,3-dihydroindole-1-carbonyl)-6-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indol-4-yl] hydrogen phosphate |
| SMILES | COc1cc2cc(C(=O)N3C[C@@H](CCl)c4c3cc(OP(=O)(O)OP(=O)(O)OCCN)c3[nH]c(C(=O)N5CCc6ccccc65)cc43)[nH]c2c(OC)c1OC |
| InChI | InChI=1S/C34H36ClN5O12P2/c1-47-27-13-19-12-22(37-29(19)32(49-3)31(27)48-2)34(42)40-17-20(16-35)28-21-14-23(33(41)39-10-8-18-6-4-5-7-24(18)39)38-30(21)26(15-25(28)40)51-54(45,46)52-53(43,44)50-11-9-36/h4-7,12-15,20,37-38H,8-11,16-17,36H2,1-3H3,(H,43,44)(H,45,46)/t20-/m1/s1 |
| InChIKey | VCKUHKCQJWZLAV-HXUWFJFHSA-N |
| XLogP | 5.43 |
| TPSA | 228.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.09 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|