C21H43N3O3 — CID 176917954
1-[3,5-di(butanoyl)-1,3,5-triazinan-1-yl]pentan-1-one;ethane;propane (PubChem CID 176917954) has the molecular formula C21H43N3O3 and a molecular weight of 385.59 g/mol. Its IUPAC name is 1-[3,5-di(butanoyl)-1,3,5-triazinan-1-yl]pentan-1-one;ethane;propane.
| Compound Name | 1-[3,5-di(butanoyl)-1,3,5-triazinan-1-yl]pentan-1-one;ethane;propane |
|---|---|
| PubChem CID | 176917954 |
| Molecular Formula | C21H43N3O3 |
| Molecular Weight | 385.59 g/mol |
| Exact Mass | 385.33 |
| IUPAC Name | 1-[3,5-di(butanoyl)-1,3,5-triazinan-1-yl]pentan-1-one;ethane;propane |
| SMILES | CC.CCC.CCCCC(=O)N1CN(C(=O)CCC)CN(C(=O)CCC)C1 |
| InChI | InChI=1S/C16H29N3O3.C3H8.C2H6/c1-4-7-10-16(22)19-12-17(14(20)8-5-2)11-18(13-19)15(21)9-6-3;1-3-2;1-2/h4-13H2,1-3H3;3H2,1-2H3;1-2H3 |
| InChIKey | RQFQTSVVASWCAA-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.59 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |