C15H18N5O3P — CID 176918443
2-[1-(7-cyano-4-oxo-3H-pyrido[3,4-d]pyridazin-5-yl)piperidin-4-yl]ethylphosphonous acid (PubChem CID 176918443) has the molecular formula C15H18N5O3P and a molecular weight of 347.32 g/mol. Its IUPAC name is 2-[1-(7-cyano-4-oxo-3H-pyrido[3,4-d]pyridazin-5-yl)piperidin-4-yl]ethylphosphonous acid.
| Compound Name | 2-[1-(7-cyano-4-oxo-3H-pyrido[3,4-d]pyridazin-5-yl)piperidin-4-yl]ethylphosphonous acid |
|---|---|
| PubChem CID | 176918443 |
| Molecular Formula | C15H18N5O3P |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 2-[1-(7-cyano-4-oxo-3H-pyrido[3,4-d]pyridazin-5-yl)piperidin-4-yl]ethylphosphonous acid |
| SMILES | N#Cc1cc2cn[nH]c(=O)c2c(N2CCC(CCP(O)O)CC2)n1 |
| InChI | InChI=1S/C15H18N5O3P/c16-8-12-7-11-9-17-19-15(21)13(11)14(18-12)20-4-1-10(2-5-20)3-6-24(22)23/h7,9-10,22-23H,1-6H2,(H,19,21) |
| InChIKey | IQMVLCXIIOFIRP-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 126.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|