C21H30F3N3O2 — CID 176922173
ethane;1-[6-(2-methoxyethyl)-1-[4-(trifluoromethoxy)phenyl]-2H-pyridin-4-yl]piperazine (PubChem CID 176922173) has the molecular formula C21H30F3N3O2 and a molecular weight of 413.48 g/mol. Its IUPAC name is ethane;1-[6-(2-methoxyethyl)-1-[4-(trifluoromethoxy)phenyl]-2H-pyridin-4-yl]piperazine.
| Compound Name | ethane;1-[6-(2-methoxyethyl)-1-[4-(trifluoromethoxy)phenyl]-2H-pyridin-4-yl]piperazine |
|---|---|
| PubChem CID | 176922173 |
| Molecular Formula | C21H30F3N3O2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | ethane;1-[6-(2-methoxyethyl)-1-[4-(trifluoromethoxy)phenyl]-2H-pyridin-4-yl]piperazine |
| SMILES | CC.COCCC1=CC(N2CCNCC2)=CCN1c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H24F3N3O2.C2H6/c1-26-13-7-17-14-16(24-11-8-23-9-12-24)6-10-25(17)15-2-4-18(5-3-15)27-19(20,21)22;1-2/h2-6,14,23H,7-13H2,1H3;1-2H3 |
| InChIKey | FZQQICKDWXLLAD-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |