C18H22F3N3O — CID 176922421
N-but-3-enyl-5-methyl-N-propyl-1-[4-(trifluoromethoxy)phenyl]pyrazol-3-amine (PubChem CID 176922421) has the molecular formula C18H22F3N3O and a molecular weight of 353.39 g/mol. Its IUPAC name is N-but-3-enyl-5-methyl-N-propyl-1-[4-(trifluoromethoxy)phenyl]pyrazol-3-amine.
| Compound Name | N-but-3-enyl-5-methyl-N-propyl-1-[4-(trifluoromethoxy)phenyl]pyrazol-3-amine |
|---|---|
| PubChem CID | 176922421 |
| Molecular Formula | C18H22F3N3O |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | N-but-3-enyl-5-methyl-N-propyl-1-[4-(trifluoromethoxy)phenyl]pyrazol-3-amine |
| SMILES | C=CCCN(CCC)c1cc(C)n(-c2ccc(OC(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C18H22F3N3O/c1-4-6-12-23(11-5-2)17-13-14(3)24(22-17)15-7-9-16(10-8-15)25-18(19,20)21/h4,7-10,13H,1,5-6,11-12H2,2-3H3 |
| InChIKey | WHCFKXAULVRSAX-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|