C17H11F3N4O — CID 137371066
2-[2-[5-methyl-1-[4-(trifluoromethoxy)phenyl]pyrazol-3-yl]ethynyl]pyrimidine (PubChem CID 137371066) has the molecular formula C17H11F3N4O and a molecular weight of 344.30 g/mol. Its IUPAC name is 2-[2-[5-methyl-1-[4-(trifluoromethoxy)phenyl]pyrazol-3-yl]ethynyl]pyrimidine.
| Compound Name | 2-[2-[5-methyl-1-[4-(trifluoromethoxy)phenyl]pyrazol-3-yl]ethynyl]pyrimidine |
|---|---|
| PubChem CID | 137371066 |
| Molecular Formula | C17H11F3N4O |
| Molecular Weight | 344.30 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 2-[2-[5-methyl-1-[4-(trifluoromethoxy)phenyl]pyrazol-3-yl]ethynyl]pyrimidine |
| SMILES | Cc1cc(C#Cc2ncccn2)nn1-c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H11F3N4O/c1-12-11-13(3-8-16-21-9-2-10-22-16)23-24(12)14-4-6-15(7-5-14)25-17(18,19)20/h2,4-7,9-11H,1H3 |
| InChIKey | LSJATVOOXOOBKI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|