C21H32F3N2OSn — CID 176921345
CID 176921345 (PubChem CID 176921345) has the molecular formula C21H32F3N2OSn and a molecular weight of 504.21 g/mol.
| Compound Name | CID 176921345 |
|---|---|
| PubChem CID | 176921345 |
| Molecular Formula | C21H32F3N2OSn |
| Molecular Weight | 504.21 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | — |
| SMILES | CC.CCCC[Sn](CCCC)c1cc(C)n(-c2ccc(OC(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C11H8F3N2O.2C4H9.C2H6.Sn/c1-8-6-7-15-16(8)9-2-4-10(5-3-9)17-11(12,13)14;2*1-3-4-2;1-2;/h2-6H,1H3;2*1,3-4H2,2H3;1-2H3; |
| InChIKey | ROFDIOZJFKUXKH-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.21 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |