C15H17F3N2O5 — CID 22475395
5-(2-butoxyethoxy)-3-[4-(trifluoromethoxy)phenyl]-1,3,4-oxadiazol-2-one (PubChem CID 22475395) has the molecular formula C15H17F3N2O5 and a molecular weight of 362.30 g/mol. Its IUPAC name is 5-(2-butoxyethoxy)-3-[4-(trifluoromethoxy)phenyl]-1,3,4-oxadiazol-2-one.
| Compound Name | 5-(2-butoxyethoxy)-3-[4-(trifluoromethoxy)phenyl]-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 22475395 |
| Molecular Formula | C15H17F3N2O5 |
| Molecular Weight | 362.30 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 5-(2-butoxyethoxy)-3-[4-(trifluoromethoxy)phenyl]-1,3,4-oxadiazol-2-one |
| SMILES | CCCCOCCOc1nn(-c2ccc(OC(F)(F)F)cc2)c(=O)o1 |
| InChI | InChI=1S/C15H17F3N2O5/c1-2-3-8-22-9-10-23-13-19-20(14(21)24-13)11-4-6-12(7-5-11)25-15(16,17)18/h4-7H,2-3,8-10H2,1H3 |
| InChIKey | KTEODHASAFPODP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 75.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|