C12H19NO — CID 176923382
5-propan-2-yloxy-1,2,3,4,7,8-hexahydroisoquinoline (PubChem CID 176923382) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 5-propan-2-yloxy-1,2,3,4,7,8-hexahydroisoquinoline.
| Compound Name | 5-propan-2-yloxy-1,2,3,4,7,8-hexahydroisoquinoline |
|---|---|
| PubChem CID | 176923382 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 5-propan-2-yloxy-1,2,3,4,7,8-hexahydroisoquinoline |
| SMILES | CC(C)OC1=CCCC2=C1CCNC2 |
| InChI | InChI=1S/C12H19NO/c1-9(2)14-12-5-3-4-10-8-13-7-6-11(10)12/h5,9,13H,3-4,6-8H2,1-2H3 |
| InChIKey | WLEWDKKKWQCPPI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |