C17H20N2O — CID 176924747
6-benzyl-5-ethyl-1,5,7,8-tetrahydro-1,6-naphthyridin-4-one (PubChem CID 176924747) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is 6-benzyl-5-ethyl-1,5,7,8-tetrahydro-1,6-naphthyridin-4-one.
| Compound Name | 6-benzyl-5-ethyl-1,5,7,8-tetrahydro-1,6-naphthyridin-4-one |
|---|---|
| PubChem CID | 176924747 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 6-benzyl-5-ethyl-1,5,7,8-tetrahydro-1,6-naphthyridin-4-one |
| SMILES | CCC1c2c([nH]ccc2=O)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C17H20N2O/c1-2-15-17-14(18-10-8-16(17)20)9-11-19(15)12-13-6-4-3-5-7-13/h3-8,10,15H,2,9,11-12H2,1H3,(H,18,20) |
| InChIKey | PLXLBAULGUPKKM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |