C15H19F2NO — CID 121308578
1-benzyl-2-(1,1-difluoropropyl)piperidin-4-one (PubChem CID 121308578) has the molecular formula C15H19F2NO and a molecular weight of 267.32 g/mol. Its IUPAC name is 1-benzyl-2-(1,1-difluoropropyl)piperidin-4-one.
| Compound Name | 1-benzyl-2-(1,1-difluoropropyl)piperidin-4-one |
|---|---|
| PubChem CID | 121308578 |
| Molecular Formula | C15H19F2NO |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 1-benzyl-2-(1,1-difluoropropyl)piperidin-4-one |
| SMILES | CCC(F)(F)C1CC(=O)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C15H19F2NO/c1-2-15(16,17)14-10-13(19)8-9-18(14)11-12-6-4-3-5-7-12/h3-7,14H,2,8-11H2,1H3 |
| InChIKey | BBMLIHLPMPIORW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |